1,4-Cyclohexanediamine,N-(7-chloro-4-quinolinyl)-N'-(5-methyl[1,1'-biphenyl]-3-yl)-, cis-,mono(trifluoroacetate)
CAS No: 589494-08-6
Hexane
589494-08-6
cyclohexanediamine,chloro,quinolinyl,methyl,biphenyl,trifluoroacetate,hexane,589494-08-6
2025-10-17 Discover 1,4-Cyclohexanediamine,N-(7-chloro-4-quinolinyl)-N'-(5-methyl[1,1'-biphenyl]-3-yl)-, cis-,mono(trifluoroacetate) (CAS No: 589494-08-6) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.